About 4-cyano-N,N,2-trimethylbenzenesulfonamide
4-cyano-N,N,2-trimethylbenzenesulfonamide (PubChem CID 103688766) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-cyano-N,N,2-trimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-N,N,2-trimethylbenzenesulfonamide |
| PubChem CID | 103688766 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-cyano-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H12N2O2S/c1-8-6-9(7-11)4-5-10(8)15(13,14)12(2)3/h4-6H,1-3H3 |
| InChIKey | UPVJLGADSAGMQW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyano-N,N,2-trimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N,N,2-trimethylbenzenesulfonamide?
The IUPAC name of 4-cyano-N,N,2-trimethylbenzenesulfonamide (CID 103688766) is 4-cyano-N,N,2-trimethylbenzenesulfonamide.
What is the SMILES notation for 4-cyano-N,N,2-trimethylbenzenesulfonamide?
The canonical SMILES for 4-cyano-N,N,2-trimethylbenzenesulfonamide is Cc1cc(C#N)ccc1S(=O)(=O)N(C)C.
What is the InChIKey of 4-cyano-N,N,2-trimethylbenzenesulfonamide?
The InChIKey is UPVJLGADSAGMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-8-6-9(7-11)4-5-10(8)15(13,14)12(2)3/h4-6H,1-3H3.
What are the key properties of 4-cyano-N,N,2-trimethylbenzenesulfonamide?
4-cyano-N,N,2-trimethylbenzenesulfonamide has a molecular weight of 224.28 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N,N,2-trimethylbenzenesulfonamide is sourced from PubChem (CID 103688766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).