C10H16N2O2S — CID 106996606
4-(aminomethyl)-N,N,2-trimethylbenzenesulfonamide (PubChem CID 106996606) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106996606 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(aminomethyl)-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(CN)ccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H16N2O2S/c1-8-6-9(7-11)4-5-10(8)15(13,14)12(2)3/h4-6H,7,11H2,1-3H3 |
| InChIKey | LLLODBJEFJNJPZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |