C10H15N3O3S — CID 106996555
2-[[4-(aminomethyl)-2-methylphenyl]sulfonylamino]acetamide (PubChem CID 106996555) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-2-methylphenyl]sulfonylamino]acetamide.
| Compound Name | 2-[[4-(aminomethyl)-2-methylphenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 106996555 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[[4-(aminomethyl)-2-methylphenyl]sulfonylamino]acetamide |
| SMILES | Cc1cc(CN)ccc1S(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C10H15N3O3S/c1-7-4-8(5-11)2-3-9(7)17(15,16)13-6-10(12)14/h2-4,13H,5-6,11H2,1H3,(H2,12,14) |
| InChIKey | FZPYOAPUSKAECG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |