C13H19BrFNO3 — CID 122143727
2-[(5-bromo-2-fluorophenyl)methyl-(2,2-dimethoxyethyl)amino]ethanol (PubChem CID 122143727) has the molecular formula C13H19BrFNO3 and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl-(2,2-dimethoxyethyl)amino]ethanol.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl-(2,2-dimethoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 122143727 |
| Molecular Formula | C13H19BrFNO3 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl-(2,2-dimethoxyethyl)amino]ethanol |
| SMILES | COC(CN(CCO)Cc1cc(Br)ccc1F)OC |
| InChI | InChI=1S/C13H19BrFNO3/c1-18-13(19-2)9-16(5-6-17)8-10-7-11(14)3-4-12(10)15/h3-4,7,13,17H,5-6,8-9H2,1-2H3 |
| InChIKey | HGVOTOPFPOIWOX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|