C13H18Br2FN — CID 80672475
N-(2-bromoethyl)-N-[(5-bromo-2-fluorophenyl)methyl]butan-1-amine (PubChem CID 80672475) has the molecular formula C13H18Br2FN and a molecular weight of 367.10 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(5-bromo-2-fluorophenyl)methyl]butan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-[(5-bromo-2-fluorophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 80672475 |
| Molecular Formula | C13H18Br2FN |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-(2-bromoethyl)-N-[(5-bromo-2-fluorophenyl)methyl]butan-1-amine |
| SMILES | CCCCN(CCBr)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H18Br2FN/c1-2-3-7-17(8-6-14)10-11-9-12(15)4-5-13(11)16/h4-5,9H,2-3,6-8,10H2,1H3 |
| InChIKey | SOYQZXYAOJRDGK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|