C15H14BrCl2FN2O — CID 56509114
2-[(5-bromo-2-fluorophenyl)methyl-[(2,6-dichloro-4-pyridinyl)methyl]amino]ethanol (PubChem CID 56509114) has the molecular formula C15H14BrCl2FN2O and a molecular weight of 408.10 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl-[(2,6-dichloro-4-pyridinyl)methyl]amino]ethanol.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl-[(2,6-dichloro-4-pyridinyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 56509114 |
| Molecular Formula | C15H14BrCl2FN2O |
| Molecular Weight | 408.10 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl-[(2,6-dichloro-4-pyridinyl)methyl]amino]ethanol |
| SMILES | OCCN(Cc1cc(Cl)nc(Cl)c1)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H14BrCl2FN2O/c16-12-1-2-13(19)11(7-12)9-21(3-4-22)8-10-5-14(17)20-15(18)6-10/h1-2,5-7,22H,3-4,8-9H2 |
| InChIKey | XMTVWCNCHWJFEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.10 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|