C18H30BrNO — CID 107870844
N-[(5-bromo-2-methoxyphenyl)methyl]-3-methyl-N-(3-methylbutyl)butan-1-amine (PubChem CID 107870844) has the molecular formula C18H30BrNO and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-3-methyl-N-(3-methylbutyl)butan-1-amine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-methyl-N-(3-methylbutyl)butan-1-amine |
|---|---|
| PubChem CID | 107870844 |
| Molecular Formula | C18H30BrNO |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-methyl-N-(3-methylbutyl)butan-1-amine |
| SMILES | COc1ccc(Br)cc1CN(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C18H30BrNO/c1-14(2)8-10-20(11-9-15(3)4)13-16-12-17(19)6-7-18(16)21-5/h6-7,12,14-15H,8-11,13H2,1-5H3 |
| InChIKey | YXWRSSOCLLPBPV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |