C13H20BrNO2 — CID 115666249
3-[(5-bromo-2-methoxyphenyl)methyl-ethylamino]propan-1-ol (PubChem CID 115666249) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)methyl-ethylamino]propan-1-ol.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)methyl-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 115666249 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)methyl-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H20BrNO2/c1-3-15(7-4-8-16)10-11-9-12(14)5-6-13(11)17-2/h5-6,9,16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | TWTHXFXIPQNODZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |