C20H27NO2 — CID 2244864
N-benzyl-N-[(2,5-dimethoxyphenyl)methyl]butan-1-amine (PubChem CID 2244864) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-benzyl-N-[(2,5-dimethoxyphenyl)methyl]butan-1-amine.
| Compound Name | N-benzyl-N-[(2,5-dimethoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 2244864 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-benzyl-N-[(2,5-dimethoxyphenyl)methyl]butan-1-amine |
| SMILES | CCCCN(Cc1ccccc1)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H27NO2/c1-4-5-13-21(15-17-9-7-6-8-10-17)16-18-14-19(22-2)11-12-20(18)23-3/h6-12,14H,4-5,13,15-16H2,1-3H3 |
| InChIKey | FNOCSTRDWWMKHP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |