C24H27NO8S — CID 66574429
(4-hydroxyphenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate (PubChem CID 66574429) has the molecular formula C24H27NO8S and a molecular weight of 489.55 g/mol. Its IUPAC name is (4-hydroxyphenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate.
| Compound Name | (4-hydroxyphenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate |
|---|---|
| PubChem CID | 66574429 |
| Molecular Formula | C24H27NO8S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (4-hydroxyphenyl) N,N-bis[(2,4-dimethoxyphenyl)methyl]sulfamate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)S(=O)(=O)Oc2ccc(O)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H27NO8S/c1-29-21-9-5-17(23(13-21)31-3)15-25(16-18-6-10-22(30-2)14-24(18)32-4)34(27,28)33-20-11-7-19(26)8-12-20/h5-14,26H,15-16H2,1-4H3 |
| InChIKey | LGGHJHREPCBKQO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |