C21H27NO6S — CID 175393000
N,N-bis[(2,4-dimethoxyphenyl)methyl]cyclopropanesulfonamide (PubChem CID 175393000) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is N,N-bis[(2,4-dimethoxyphenyl)methyl]cyclopropanesulfonamide.
| Compound Name | N,N-bis[(2,4-dimethoxyphenyl)methyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 175393000 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N,N-bis[(2,4-dimethoxyphenyl)methyl]cyclopropanesulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)S(=O)(=O)C2CC2)c(OC)c1 |
| InChI | InChI=1S/C21H27NO6S/c1-25-17-7-5-15(20(11-17)27-3)13-22(29(23,24)19-9-10-19)14-16-6-8-18(26-2)12-21(16)28-4/h5-8,11-12,19H,9-10,13-14H2,1-4H3 |
| InChIKey | UJSJCFKXXBMGAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |