C25H29BFNO8S — CID 176706482
[3-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-6-fluoro-2-methylphenyl]boronic acid (PubChem CID 176706482) has the molecular formula C25H29BFNO8S and a molecular weight of 533.38 g/mol. Its IUPAC name is [3-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-6-fluoro-2-methylphenyl]boronic acid.
| Compound Name | [3-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-6-fluoro-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 176706482 |
| Molecular Formula | C25H29BFNO8S |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [3-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-6-fluoro-2-methylphenyl]boronic acid |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)S(=O)(=O)c2ccc(F)c(B(O)O)c2C)c(OC)c1 |
| InChI | InChI=1S/C25H29BFNO8S/c1-16-24(11-10-21(27)25(16)26(29)30)37(31,32)28(14-17-6-8-19(33-2)12-22(17)35-4)15-18-7-9-20(34-3)13-23(18)36-5/h6-13,29-30H,14-15H2,1-5H3 |
| InChIKey | ASQIZPDVURIDTO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|