C32H29F4NO8S — CID 155578355
benzyl 2-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3,4,5,6-tetrafluorobenzoate (PubChem CID 155578355) has the molecular formula C32H29F4NO8S and a molecular weight of 663.64 g/mol. Its IUPAC name is benzyl 2-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3,4,5,6-tetrafluorobenzoate.
| Compound Name | benzyl 2-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3,4,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 155578355 |
| Molecular Formula | C32H29F4NO8S |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | benzyl 2-[bis[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3,4,5,6-tetrafluorobenzoate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2C(=O)OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H29F4NO8S/c1-41-22-12-10-20(24(14-22)43-3)16-37(17-21-11-13-23(42-2)15-25(21)44-4)46(39,40)31-26(27(33)28(34)29(35)30(31)36)32(38)45-18-19-8-6-5-7-9-19/h5-15H,16-18H2,1-4H3 |
| InChIKey | GYUFULAHCOWPHR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|