C21H14F5NO5S — CID 155578382
benzyl 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 155578382) has the molecular formula C21H14F5NO5S and a molecular weight of 487.40 g/mol. Its IUPAC name is benzyl 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | benzyl 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155578382 |
| Molecular Formula | C21H14F5NO5S |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | benzyl 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2C(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C21H14F5NO5S/c1-31-14-8-7-12(9-13(14)22)27-33(29,30)20-15(16(23)17(24)18(25)19(20)26)21(28)32-10-11-5-3-2-4-6-11/h2-9,27H,10H2,1H3 |
| InChIKey | UTLPNIRYIKCXBQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|