C24H25FN2O6S — CID 145483719
ethyl 4-[[N-[(Z)-but-1-en-3-ynyl]-C-methylcarbonimidoyl]-[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3-fluorobenzoate (PubChem CID 145483719) has the molecular formula C24H25FN2O6S and a molecular weight of 488.54 g/mol. Its IUPAC name is ethyl 4-[[N-[(Z)-but-1-en-3-ynyl]-C-methylcarbonimidoyl]-[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3-fluorobenzoate.
| Compound Name | ethyl 4-[[N-[(Z)-but-1-en-3-ynyl]-C-methylcarbonimidoyl]-[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 145483719 |
| Molecular Formula | C24H25FN2O6S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | ethyl 4-[[N-[(Z)-but-1-en-3-ynyl]-C-methylcarbonimidoyl]-[(2,4-dimethoxyphenyl)methyl]sulfamoyl]-3-fluorobenzoate |
| SMILES | C#C/C=C\N=C(/C)N(Cc1ccc(OC)cc1OC)S(=O)(=O)c1ccc(C(=O)OCC)cc1F |
| InChI | InChI=1S/C24H25FN2O6S/c1-6-8-13-26-17(3)27(16-19-9-11-20(31-4)15-22(19)32-5)34(29,30)23-12-10-18(14-21(23)25)24(28)33-7-2/h1,8-15H,7,16H2,2-5H3/b13-8-,26-17+ |
| InChIKey | DIQNRVMODVPQPQ-ZMAAICQESA-N |
| XLogP | 3.78 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|