C25H22F5N3O6S2 — CID 123349101
(methylideneamino) N-[2,5-difluoro-4-[3-methoxy-5-(trifluoromethyl)phenoxy]phenyl]sulfonyl-N-[(2,4-dimethoxyphenyl)methyl]carbamimidothioate (PubChem CID 123349101) has the molecular formula C25H22F5N3O6S2 and a molecular weight of 619.59 g/mol. Its IUPAC name is (methylideneamino) N-[2,5-difluoro-4-[3-methoxy-5-(trifluoromethyl)phenoxy]phenyl]sulfonyl-N-[(2,4-dimethoxyphenyl)methyl]carbamimidothioate.
| Compound Name | (methylideneamino) N-[2,5-difluoro-4-[3-methoxy-5-(trifluoromethyl)phenoxy]phenyl]sulfonyl-N-[(2,4-dimethoxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 123349101 |
| Molecular Formula | C25H22F5N3O6S2 |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | (methylideneamino) N-[2,5-difluoro-4-[3-methoxy-5-(trifluoromethyl)phenoxy]phenyl]sulfonyl-N-[(2,4-dimethoxyphenyl)methyl]carbamimidothioate |
| SMILES | [H]/N=C(\SN=C)N(Cc1ccc(OC)cc1OC)S(=O)(=O)c1cc(F)c(Oc2cc(OC)cc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C25H22F5N3O6S2/c1-32-40-24(31)33(13-14-5-6-16(36-2)10-21(14)38-4)41(34,35)23-12-19(26)22(11-20(23)27)39-18-8-15(25(28,29)30)7-17(9-18)37-3/h5-12,31H,1,13H2,2-4H3/b31-24- |
| InChIKey | NETRVCXIBVJEMN-QLTSDVKISA-N |
| XLogP | 6.28 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|