About 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene
1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene (PubChem CID 166959832) has the molecular formula C18H17F5O
and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene |
| PubChem CID | 166959832 |
| Molecular Formula | C18H17F5O |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene |
| SMILES | Cc1cc(F)c(Oc2cc(C(C)(C)F)cc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C18H17F5O/c1-10-5-15(19)16(6-11(10)2)24-14-8-12(17(3,4)20)7-13(9-14)18(21,22)23/h5-9H,1-4H3 |
| InChIKey | NOBJEPLYJDHDIL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene?
The IUPAC name of 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene (CID 166959832) is 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene.
What is the SMILES notation for 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene?
The canonical SMILES for 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene is Cc1cc(F)c(Oc2cc(C(C)(C)F)cc(C(F)(F)F)c2)cc1C.
What is the InChIKey of 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene?
The InChIKey is NOBJEPLYJDHDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F5O/c1-10-5-15(19)16(6-11(10)2)24-14-8-12(17(3,4)20)7-13(9-14)18(21,22)23/h5-9H,1-4H3.
What are the key properties of 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene?
1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene has a molecular weight of 344.32 g/mol, XLogP of 6.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-[3-(2-fluoropropan-2-yl)-5-(trifluoromethyl)phenoxy]-4,5-dimethylbenzene is sourced from PubChem (CID 166959832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).