C16H18N2O6S — CID 100526233
N-(2,4-dimethoxyphenyl)-N-ethyl-4-nitrobenzenesulfonamide (PubChem CID 100526233) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N-ethyl-4-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N-ethyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 100526233 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N-ethyl-4-nitrobenzenesulfonamide |
| SMILES | CCN(c1ccc(OC)cc1OC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O6S/c1-4-17(15-10-7-13(23-2)11-16(15)24-3)25(21,22)14-8-5-12(6-9-14)18(19)20/h5-11H,4H2,1-3H3 |
| InChIKey | BHQWYQZEWPTUPQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|