C27H27N3O7 — CID 71054851
4-[(2,4-dimethoxyphenyl)methyl]-2,9-dimethyl-N-(4-nitrophenyl)-3-oxo-5H-1,4-benzoxazepine-5-carboxamide (PubChem CID 71054851) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-2,9-dimethyl-N-(4-nitrophenyl)-3-oxo-5H-1,4-benzoxazepine-5-carboxamide.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-2,9-dimethyl-N-(4-nitrophenyl)-3-oxo-5H-1,4-benzoxazepine-5-carboxamide |
|---|---|
| PubChem CID | 71054851 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-2,9-dimethyl-N-(4-nitrophenyl)-3-oxo-5H-1,4-benzoxazepine-5-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C(C)Oc3c(C)cccc3C2C(=O)Nc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C27H27N3O7/c1-16-6-5-7-22-24(26(31)28-19-9-11-20(12-10-19)30(33)34)29(27(32)17(2)37-25(16)22)15-18-8-13-21(35-3)14-23(18)36-4/h5-14,17,24H,15H2,1-4H3,(H,28,31) |
| InChIKey | ZMWCIGMEAMSNJD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|