C19H20BrNO4 — CID 67352581
(6R)-6-(4-bromophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-3-one (PubChem CID 67352581) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is (6R)-6-(4-bromophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-3-one.
| Compound Name | (6R)-6-(4-bromophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-3-one |
|---|---|
| PubChem CID | 67352581 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (6R)-6-(4-bromophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-3-one |
| SMILES | COc1ccc(CN2C[C@@H](c3ccc(Br)cc3)OCC2=O)c(OC)c1 |
| InChI | InChI=1S/C19H20BrNO4/c1-23-16-8-5-14(17(9-16)24-2)10-21-11-18(25-12-19(21)22)13-3-6-15(20)7-4-13/h3-9,18H,10-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | PCDPFWRTMUNJKK-SFHVURJKSA-N |
| XLogP | 3.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |