C12H17FN2S — CID 64767814
5-fluoro-2-(1,4-thiazepan-4-ylmethyl)aniline (PubChem CID 64767814) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-fluoro-2-(1,4-thiazepan-4-ylmethyl)aniline.
| Compound Name | 5-fluoro-2-(1,4-thiazepan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 64767814 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-fluoro-2-(1,4-thiazepan-4-ylmethyl)aniline |
| SMILES | Nc1cc(F)ccc1CN1CCCSCC1 |
| InChI | InChI=1S/C12H17FN2S/c13-11-3-2-10(12(14)8-11)9-15-4-1-6-16-7-5-15/h2-3,8H,1,4-7,9,14H2 |
| InChIKey | QCODVPJCYNQVAT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|