C15H20N2S — CID 54969955
3-[2-(1,4-thiazepan-4-ylmethyl)phenyl]prop-2-yn-1-amine (PubChem CID 54969955) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 3-[2-(1,4-thiazepan-4-ylmethyl)phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-(1,4-thiazepan-4-ylmethyl)phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 54969955 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-[2-(1,4-thiazepan-4-ylmethyl)phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccccc1CN1CCCSCC1 |
| InChI | InChI=1S/C15H20N2S/c16-8-3-7-14-5-1-2-6-15(14)13-17-9-4-11-18-12-10-17/h1-2,5-6H,4,8-13,16H2 |
| InChIKey | KCFCROQZGXJYHA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|