C21H27NO — CID 7911115
2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dimethylphenol (PubChem CID 7911115) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dimethylphenol.
| Compound Name | 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 7911115 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-[(4-benzylpiperidin-1-yl)methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CN2CCC(Cc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C21H27NO/c1-16-12-20(21(23)13-17(16)2)15-22-10-8-19(9-11-22)14-18-6-4-3-5-7-18/h3-7,12-13,19,23H,8-11,14-15H2,1-2H3 |
| InChIKey | KSYBZJCFJMIKNM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|