C21H27NO2 — CID 2491619
2-[(4-benzylpiperidin-1-yl)methyl]-6-methoxy-4-methylphenol (PubChem CID 2491619) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(4-benzylpiperidin-1-yl)methyl]-6-methoxy-4-methylphenol.
| Compound Name | 2-[(4-benzylpiperidin-1-yl)methyl]-6-methoxy-4-methylphenol |
|---|---|
| PubChem CID | 2491619 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[(4-benzylpiperidin-1-yl)methyl]-6-methoxy-4-methylphenol |
| SMILES | COc1cc(C)cc(CN2CCC(Cc3ccccc3)CC2)c1O |
| InChI | InChI=1S/C21H27NO2/c1-16-12-19(21(23)20(13-16)24-2)15-22-10-8-18(9-11-22)14-17-6-4-3-5-7-17/h3-7,12-13,18,23H,8-11,14-15H2,1-2H3 |
| InChIKey | CFGVTDHZGNENDD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|