C9H12F2O — CID 143572521
2,6-difluoro-3-methylphenol;ethane (PubChem CID 143572521) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is 2,6-difluoro-3-methylphenol;ethane.
| Compound Name | 2,6-difluoro-3-methylphenol;ethane |
|---|---|
| PubChem CID | 143572521 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2,6-difluoro-3-methylphenol;ethane |
| SMILES | CC.Cc1ccc(F)c(O)c1F |
| InChI | InChI=1S/C7H6F2O.C2H6/c1-4-2-3-5(8)7(10)6(4)9;1-2/h2-3,10H,1H3;1-2H3 |
| InChIKey | FRKHRFXLTCPNEH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |