About 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol
1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol (PubChem CID 174453955) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol.
Molecular Properties
| Compound Name | 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol |
| PubChem CID | 174453955 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol |
| SMILES | CC(=O)c1cccc(O)c1N.Nc1ccccc1O |
| InChI | InChI=1S/C8H9NO2.C6H7NO/c1-5(10)6-3-2-4-7(11)8(6)9;7-5-3-1-2-4-6(5)8/h2-4,11H,9H2,1H3;1-4,8H,7H2 |
| InChIKey | OXSCVKGPAYKONR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol?
The IUPAC name of 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol (CID 174453955) is 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol.
What is the SMILES notation for 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol?
The canonical SMILES for 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol is CC(=O)c1cccc(O)c1N.Nc1ccccc1O.
What is the InChIKey of 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol?
The InChIKey is OXSCVKGPAYKONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H7NO/c1-5(10)6-3-2-4-7(11)8(6)9;7-5-3-1-2-4-6(5)8/h2-4,11H,9H2,1H3;1-4,8H,7H2.
What are the key properties of 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol?
1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol has a molecular weight of 260.29 g/mol, XLogP of 2.15, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-3-hydroxyphenyl)ethanone;2-aminophenol is sourced from PubChem (CID 174453955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).