About bis(1-(2-hydroxyphenyl)ethanone);zirconium
bis(1-(2-hydroxyphenyl)ethanone);zirconium (PubChem CID 87865139) has the molecular formula C16H16O4Zr
and a molecular weight of 363.52 g/mol. Its IUPAC name is bis(1-(2-hydroxyphenyl)ethanone);zirconium.
Molecular Properties
| Compound Name | bis(1-(2-hydroxyphenyl)ethanone);zirconium |
| PubChem CID | 87865139 |
| Molecular Formula | C16H16O4Zr |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | bis(1-(2-hydroxyphenyl)ethanone);zirconium |
| SMILES | CC(=O)c1ccccc1O.CC(=O)c1ccccc1O.[Zr] |
| InChI | InChI=1S/2C8H8O2.Zr/c2*1-6(9)7-4-2-3-5-8(7)10;/h2*2-5,10H,1H3; |
| InChIKey | PRIQEKWDQRNNMK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(1-(2-hydroxyphenyl)ethanone);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(2-hydroxyphenyl)ethanone);zirconium?
The IUPAC name of bis(1-(2-hydroxyphenyl)ethanone);zirconium (CID 87865139) is bis(1-(2-hydroxyphenyl)ethanone);zirconium.
What is the SMILES notation for bis(1-(2-hydroxyphenyl)ethanone);zirconium?
The canonical SMILES for bis(1-(2-hydroxyphenyl)ethanone);zirconium is CC(=O)c1ccccc1O.CC(=O)c1ccccc1O.[Zr].
What is the InChIKey of bis(1-(2-hydroxyphenyl)ethanone);zirconium?
The InChIKey is PRIQEKWDQRNNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8O2.Zr/c2*1-6(9)7-4-2-3-5-8(7)10;/h2*2-5,10H,1H3;.
What are the key properties of bis(1-(2-hydroxyphenyl)ethanone);zirconium?
bis(1-(2-hydroxyphenyl)ethanone);zirconium has a molecular weight of 363.52 g/mol, XLogP of 3.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(2-hydroxyphenyl)ethanone);zirconium is sourced from PubChem (CID 87865139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).