About ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol
ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol (PubChem CID 172964742) has the molecular formula C21H31NO4
and a molecular weight of 361.48 g/mol. Its IUPAC name is ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol.
Molecular Properties
| Compound Name | ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol |
| PubChem CID | 172964742 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol |
| SMILES | CC.CC.CC(=O)c1ccccc1O.CO/N=C(\C)c1ccccc1O |
| InChI | InChI=1S/C9H11NO2.C8H8O2.2C2H6/c1-7(10-12-2)8-5-3-4-6-9(8)11;1-6(9)7-4-2-3-5-8(7)10;2*1-2/h3-6,11H,1-2H3;2-5,10H,1H3;2*1-2H3/b10-7+;;; |
| InChIKey | HRNLETYXYUAIBY-ICWQEWPPSA-N |
| XLogP | 5.41 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol?
The IUPAC name of ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol (CID 172964742) is ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol.
What is the SMILES notation for ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol?
The canonical SMILES for ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol is CC.CC.CC(=O)c1ccccc1O.CO/N=C(\C)c1ccccc1O.
What is the InChIKey of ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol?
The InChIKey is HRNLETYXYUAIBY-ICWQEWPPSA-N. The full InChI is InChI=1S/C9H11NO2.C8H8O2.2C2H6/c1-7(10-12-2)8-5-3-4-6-9(8)11;1-6(9)7-4-2-3-5-8(7)10;2*1-2/h3-6,11H,1-2H3;2-5,10H,1H3;2*1-2H3/b10-7+;;;.
What are the key properties of ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol?
ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol has a molecular weight of 361.48 g/mol, XLogP of 5.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-hydroxyphenyl)ethanone;2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenol is sourced from PubChem (CID 172964742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).