About 3-aminonaphthalene-2-carboxylic acid;2-aminophenol
3-aminonaphthalene-2-carboxylic acid;2-aminophenol (PubChem CID 70253248) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-aminonaphthalene-2-carboxylic acid;2-aminophenol.
Molecular Properties
| Compound Name | 3-aminonaphthalene-2-carboxylic acid;2-aminophenol |
| PubChem CID | 70253248 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-aminonaphthalene-2-carboxylic acid;2-aminophenol |
| SMILES | Nc1cc2ccccc2cc1C(=O)O.Nc1ccccc1O |
| InChI | InChI=1S/C11H9NO2.C6H7NO/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;7-5-3-1-2-4-6(5)8/h1-6H,12H2,(H,13,14);1-4,8H,7H2 |
| InChIKey | KKZAXISVDXIXCW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-aminonaphthalene-2-carboxylic acid;2-aminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminonaphthalene-2-carboxylic acid;2-aminophenol?
The IUPAC name of 3-aminonaphthalene-2-carboxylic acid;2-aminophenol (CID 70253248) is 3-aminonaphthalene-2-carboxylic acid;2-aminophenol.
What is the SMILES notation for 3-aminonaphthalene-2-carboxylic acid;2-aminophenol?
The canonical SMILES for 3-aminonaphthalene-2-carboxylic acid;2-aminophenol is Nc1cc2ccccc2cc1C(=O)O.Nc1ccccc1O.
What is the InChIKey of 3-aminonaphthalene-2-carboxylic acid;2-aminophenol?
The InChIKey is KKZAXISVDXIXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2.C6H7NO/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14;7-5-3-1-2-4-6(5)8/h1-6H,12H2,(H,13,14);1-4,8H,7H2.
What are the key properties of 3-aminonaphthalene-2-carboxylic acid;2-aminophenol?
3-aminonaphthalene-2-carboxylic acid;2-aminophenol has a molecular weight of 296.33 g/mol, XLogP of 3.09, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminonaphthalene-2-carboxylic acid;2-aminophenol is sourced from PubChem (CID 70253248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).