About 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide
3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide (PubChem CID 14678741) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide |
| PubChem CID | 14678741 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2cc1N)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O/c1-20(15-9-3-2-4-10-15)18(21)16-11-13-7-5-6-8-14(13)12-17(16)19/h2-12H,19H2,1H3 |
| InChIKey | JOKGKLHDDULTJL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide?
The IUPAC name of 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide (CID 14678741) is 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide.
What is the SMILES notation for 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide?
The canonical SMILES for 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide is CN(C(=O)c1cc2ccccc2cc1N)c1ccccc1.
What is the InChIKey of 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide?
The InChIKey is JOKGKLHDDULTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c1-20(15-9-3-2-4-10-15)18(21)16-11-13-7-5-6-8-14(13)12-17(16)19/h2-12H,19H2,1H3.
What are the key properties of 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide?
3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide has a molecular weight of 276.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-methyl-N-phenylnaphthalene-2-carboxamide is sourced from PubChem (CID 14678741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).