C15H15N3O — CID 61207818
3-amino-N-(2-cyanoethyl)-N-methylnaphthalene-2-carboxamide (PubChem CID 61207818) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-N-(2-cyanoethyl)-N-methylnaphthalene-2-carboxamide.
| Compound Name | 3-amino-N-(2-cyanoethyl)-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 61207818 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-amino-N-(2-cyanoethyl)-N-methylnaphthalene-2-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1cc2ccccc2cc1N |
| InChI | InChI=1S/C15H15N3O/c1-18(8-4-7-16)15(19)13-9-11-5-2-3-6-12(11)10-14(13)17/h2-3,5-6,9-10H,4,8,17H2,1H3 |
| InChIKey | KHBPPDGITZGTRN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|