C14H14N4O — CID 63377285
4-amino-N-(2-cyanoethyl)-N-methylquinoline-2-carboxamide (PubChem CID 63377285) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-amino-N-(2-cyanoethyl)-N-methylquinoline-2-carboxamide.
| Compound Name | 4-amino-N-(2-cyanoethyl)-N-methylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 63377285 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-amino-N-(2-cyanoethyl)-N-methylquinoline-2-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1cc(N)c2ccccc2n1 |
| InChI | InChI=1S/C14H14N4O/c1-18(8-4-7-15)14(19)13-9-11(16)10-5-2-3-6-12(10)17-13/h2-3,5-6,9H,4,8H2,1H3,(H2,16,17) |
| InChIKey | ZFBYHBKBZOKHAX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |