C15H20N4 — CID 88866227
1-N-methyl-2-N-[[2-(methylamino)anilino]methyl]benzene-1,2-diamine (PubChem CID 88866227) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-N-methyl-2-N-[[2-(methylamino)anilino]methyl]benzene-1,2-diamine.
| Compound Name | 1-N-methyl-2-N-[[2-(methylamino)anilino]methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 88866227 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-N-methyl-2-N-[[2-(methylamino)anilino]methyl]benzene-1,2-diamine |
| SMILES | CNc1ccccc1NCNc1ccccc1NC |
| InChI | InChI=1S/C15H20N4/c1-16-12-7-3-5-9-14(12)18-11-19-15-10-6-4-8-13(15)17-2/h3-10,16-19H,11H2,1-2H3 |
| InChIKey | GKOSIXJKFSBWII-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|