C8H11IN2 — CID 139409605
2-N-(iodomethyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 139409605) has the molecular formula C8H11IN2 and a molecular weight of 262.09 g/mol. Its IUPAC name is 2-N-(iodomethyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(iodomethyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 139409605 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-N-(iodomethyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | CNc1ccccc1NCI |
| InChI | InChI=1S/C8H11IN2/c1-10-7-4-2-3-5-8(7)11-6-9/h2-5,10-11H,6H2,1H3 |
| InChIKey | VRRPXAOICRFBRZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|