C11H19N3 — CID 76677736
2-N-(2-aminobutyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 76677736) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-N-(2-aminobutyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-aminobutyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 76677736 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-N-(2-aminobutyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | CCC(N)CNc1ccccc1NC |
| InChI | InChI=1S/C11H19N3/c1-3-9(12)8-14-11-7-5-4-6-10(11)13-2/h4-7,9,13-14H,3,8,12H2,1-2H3 |
| InChIKey | QGNAQIRUADSTKU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|