C19H26N2 — CID 62254062
1-N-(2-benzylphenyl)-3-methylpentane-1,2-diamine (PubChem CID 62254062) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-N-(2-benzylphenyl)-3-methylpentane-1,2-diamine.
| Compound Name | 1-N-(2-benzylphenyl)-3-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62254062 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-N-(2-benzylphenyl)-3-methylpentane-1,2-diamine |
| SMILES | CCC(C)C(N)CNc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2/c1-3-15(2)18(20)14-21-19-12-8-7-11-17(19)13-16-9-5-4-6-10-16/h4-12,15,18,21H,3,13-14,20H2,1-2H3 |
| InChIKey | AHPWRERRALHPAY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |