C19H26N2 — CID 65232660
N'-(2-benzylphenyl)-2-propylpropane-1,3-diamine (PubChem CID 65232660) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N'-(2-benzylphenyl)-2-propylpropane-1,3-diamine.
| Compound Name | N'-(2-benzylphenyl)-2-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 65232660 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N'-(2-benzylphenyl)-2-propylpropane-1,3-diamine |
| SMILES | CCCC(CN)CNc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2/c1-2-8-17(14-20)15-21-19-12-7-6-11-18(19)13-16-9-4-3-5-10-16/h3-7,9-12,17,21H,2,8,13-15,20H2,1H3 |
| InChIKey | FLHDYWPIXGHPBI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |