C7H9F5N2S — CID 89401746
1-N-methyl-4-(pentafluoro-λ6-sulfanyl)benzene-1,2-diamine (PubChem CID 89401746) has the molecular formula C7H9F5N2S and a molecular weight of 248.22 g/mol. Its IUPAC name is 1-N-methyl-4-(pentafluoro-λ6-sulfanyl)benzene-1,2-diamine.
| Compound Name | 1-N-methyl-4-(pentafluoro-λ6-sulfanyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 89401746 |
| Molecular Formula | C7H9F5N2S |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-N-methyl-4-(pentafluoro-λ6-sulfanyl)benzene-1,2-diamine |
| SMILES | CNc1ccc(S(F)(F)(F)(F)F)cc1N |
| InChI | InChI=1S/C7H9F5N2S/c1-14-7-3-2-5(4-6(7)13)15(8,9,10,11)12/h2-4,14H,13H2,1H3 |
| InChIKey | WOVAYCFOBRQIQI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|