About N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline
N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline (PubChem CID 146742531) has the molecular formula C7H7F5N2OS
and a molecular weight of 262.20 g/mol. Its IUPAC name is N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline.
Molecular Properties
| Compound Name | N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline |
| PubChem CID | 146742531 |
| Molecular Formula | C7H7F5N2OS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline |
| SMILES | CNc1ccc(S(F)(F)(F)(F)F)cc1N=O |
| InChI | InChI=1S/C7H7F5N2OS/c1-13-6-3-2-5(4-7(6)14-15)16(8,9,10,11)12/h2-4,13H,1H3 |
| InChIKey | RLCGEEGLAYBTFI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline?
The IUPAC name of N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline (CID 146742531) is N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline.
What is the SMILES notation for N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline?
The canonical SMILES for N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline is CNc1ccc(S(F)(F)(F)(F)F)cc1N=O.
What is the InChIKey of N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline?
The InChIKey is RLCGEEGLAYBTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F5N2OS/c1-13-6-3-2-5(4-7(6)14-15)16(8,9,10,11)12/h2-4,13H,1H3.
What are the key properties of N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline?
N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline has a molecular weight of 262.20 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-nitroso-4-(pentafluoro-λ6-sulfanyl)aniline is sourced from PubChem (CID 146742531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).