C11H14F5NO4S2 — CID 153282074
2-(tert-butylsulfonylamino)-4-(pentafluoro-λ6-sulfanyl)benzoic acid (PubChem CID 153282074) has the molecular formula C11H14F5NO4S2 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-(tert-butylsulfonylamino)-4-(pentafluoro-λ6-sulfanyl)benzoic acid.
| Compound Name | 2-(tert-butylsulfonylamino)-4-(pentafluoro-λ6-sulfanyl)benzoic acid |
|---|---|
| PubChem CID | 153282074 |
| Molecular Formula | C11H14F5NO4S2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 2-(tert-butylsulfonylamino)-4-(pentafluoro-λ6-sulfanyl)benzoic acid |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cc(S(F)(F)(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C11H14F5NO4S2/c1-11(2,3)22(20,21)17-9-6-7(23(12,13,14,15)16)4-5-8(9)10(18)19/h4-6,17H,1-3H3,(H,18,19) |
| InChIKey | GVYKRIASFPMXHB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |