C15H17NO4S — CID 63688592
3-(tert-butylsulfonylamino)naphthalene-2-carboxylic acid (PubChem CID 63688592) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-(tert-butylsulfonylamino)naphthalene-2-carboxylic acid.
| Compound Name | 3-(tert-butylsulfonylamino)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 63688592 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(tert-butylsulfonylamino)naphthalene-2-carboxylic acid |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C15H17NO4S/c1-15(2,3)21(19,20)16-13-9-11-7-5-4-6-10(11)8-12(13)14(17)18/h4-9,16H,1-3H3,(H,17,18) |
| InChIKey | JTJHIMYGLYDIEE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |