C10H11NO — CID 144615243
2-(2,4-dimethylanilino)ethynol (PubChem CID 144615243) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)ethynol.
| Compound Name | 2-(2,4-dimethylanilino)ethynol |
|---|---|
| PubChem CID | 144615243 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(2,4-dimethylanilino)ethynol |
| SMILES | Cc1ccc(NC#CO)c(C)c1 |
| InChI | InChI=1S/C10H11NO/c1-8-3-4-10(9(2)7-8)11-5-6-12/h3-4,7,11-12H,1-2H3 |
| InChIKey | JNHKIRFZCJYQSM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|