C12H13N3 — CID 157042736
1-N-methyl-3-N-pyridin-4-ylbenzene-1,3-diamine (PubChem CID 157042736) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1-N-methyl-3-N-pyridin-4-ylbenzene-1,3-diamine.
| Compound Name | 1-N-methyl-3-N-pyridin-4-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 157042736 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-N-methyl-3-N-pyridin-4-ylbenzene-1,3-diamine |
| SMILES | CNc1cccc(Nc2ccncc2)c1 |
| InChI | InChI=1S/C12H13N3/c1-13-11-3-2-4-12(9-11)15-10-5-7-14-8-6-10/h2-9,13H,1H3,(H,14,15) |
| InChIKey | WNCOVVVAKUVFGM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |