C13H15N3 — CID 117041090
1-N,3-N-dimethyl-3-N-pyridin-4-ylbenzene-1,3-diamine (PubChem CID 117041090) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-3-N-pyridin-4-ylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-3-N-pyridin-4-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 117041090 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-N,3-N-dimethyl-3-N-pyridin-4-ylbenzene-1,3-diamine |
| SMILES | CNc1cccc(N(C)c2ccncc2)c1 |
| InChI | InChI=1S/C13H15N3/c1-14-11-4-3-5-13(10-11)16(2)12-6-8-15-9-7-12/h3-10,14H,1-2H3 |
| InChIKey | IVANSNPLKMIZFK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |