C16H20N2 — CID 117028941
3-N-(4-ethylphenyl)-1-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 117028941) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-N-(4-ethylphenyl)-1-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 3-N-(4-ethylphenyl)-1-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 117028941 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-N-(4-ethylphenyl)-1-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CCc1ccc(N(C)c2cccc(NC)c2)cc1 |
| InChI | InChI=1S/C16H20N2/c1-4-13-8-10-15(11-9-13)18(3)16-7-5-6-14(12-16)17-2/h5-12,17H,4H2,1-3H3 |
| InChIKey | LDSVFRMXHNQBPH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |