C13H13Cl2N3 — CID 104532261
5-N-(3,4-dichlorophenyl)-3-N-ethylpyridine-3,5-diamine (PubChem CID 104532261) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 5-N-(3,4-dichlorophenyl)-3-N-ethylpyridine-3,5-diamine.
| Compound Name | 5-N-(3,4-dichlorophenyl)-3-N-ethylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532261 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 5-N-(3,4-dichlorophenyl)-3-N-ethylpyridine-3,5-diamine |
| SMILES | CCNc1cncc(Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H13Cl2N3/c1-2-17-10-5-11(8-16-7-10)18-9-3-4-12(14)13(15)6-9/h3-8,17-18H,2H2,1H3 |
| InChIKey | WPDOECDRJKEDLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |