C17H22N4 — CID 104534517
3-N-ethyl-5-N-(4-pyrrolidin-1-ylphenyl)pyridine-3,5-diamine (PubChem CID 104534517) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-N-ethyl-5-N-(4-pyrrolidin-1-ylphenyl)pyridine-3,5-diamine.
| Compound Name | 3-N-ethyl-5-N-(4-pyrrolidin-1-ylphenyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104534517 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-N-ethyl-5-N-(4-pyrrolidin-1-ylphenyl)pyridine-3,5-diamine |
| SMILES | CCNc1cncc(Nc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C17H22N4/c1-2-19-15-11-16(13-18-12-15)20-14-5-7-17(8-6-14)21-9-3-4-10-21/h5-8,11-13,19-20H,2-4,9-10H2,1H3 |
| InChIKey | SMZQDQBRJZLOQQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|