C15H18ClN3O2 — CID 104532128
5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-ethylpyridine-3,5-diamine (PubChem CID 104532128) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-ethylpyridine-3,5-diamine.
| Compound Name | 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-ethylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532128 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-N-(4-chloro-2,5-dimethoxyphenyl)-3-N-ethylpyridine-3,5-diamine |
| SMILES | CCNc1cncc(Nc2cc(OC)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-4-18-10-5-11(9-17-8-10)19-13-7-14(20-2)12(16)6-15(13)21-3/h5-9,18-19H,4H2,1-3H3 |
| InChIKey | GSUUAVRAJAQWCV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |