C17H17Cl2N3O — CID 109226426
[5-(3,4-dichloroanilino)-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 109226426) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is [5-(3,4-dichloroanilino)-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-(3,4-dichloroanilino)-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 109226426 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [5-(3,4-dichloroanilino)-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cncc(Nc2ccc(Cl)c(Cl)c2)c1)N1CCCCC1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-15-5-4-13(9-16(15)19)21-14-8-12(10-20-11-14)17(23)22-6-2-1-3-7-22/h4-5,8-11,21H,1-3,6-7H2 |
| InChIKey | OMEMVCYZXHOQHJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |