C16H15F2N3O — CID 109225687
[5-(3,4-difluoroanilino)-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 109225687) has the molecular formula C16H15F2N3O and a molecular weight of 303.31 g/mol. Its IUPAC name is [5-(3,4-difluoroanilino)-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(3,4-difluoroanilino)-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109225687 |
| Molecular Formula | C16H15F2N3O |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [5-(3,4-difluoroanilino)-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cncc(Nc2ccc(F)c(F)c2)c1)N1CCCC1 |
| InChI | InChI=1S/C16H15F2N3O/c17-14-4-3-12(8-15(14)18)20-13-7-11(9-19-10-13)16(22)21-5-1-2-6-21/h3-4,7-10,20H,1-2,5-6H2 |
| InChIKey | SQBWLMWPNVJJBQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |